C10H9F6NO — CID 142892422
N-[[3,4-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]formamide (PubChem CID 142892422) has the molecular formula C10H9F6NO and a molecular weight of 273.18 g/mol. Its IUPAC name is N-[[3,4-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]formamide.
| Compound Name | N-[[3,4-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]formamide |
|---|---|
| PubChem CID | 142892422 |
| Molecular Formula | C10H9F6NO |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[[3,4-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]formamide |
| SMILES | O=CNCC1=CC(C(F)(F)F)C(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C10H9F6NO/c11-9(12,13)7-2-1-6(4-17-5-18)3-8(7)10(14,15)16/h1-3,5,7-8H,4H2,(H,17,18) |
| InChIKey | KZHYMTDCEJFUBC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|