C14H21F2NO — CID 144992908
N-[(2Z,3Z,5E)-2-butan-2-ylidene-5-(1,1-difluoroethyl)hepta-3,5-dienyl]formamide (PubChem CID 144992908) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is N-[(2Z,3Z,5E)-2-butan-2-ylidene-5-(1,1-difluoroethyl)hepta-3,5-dienyl]formamide.
| Compound Name | N-[(2Z,3Z,5E)-2-butan-2-ylidene-5-(1,1-difluoroethyl)hepta-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 144992908 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[(2Z,3Z,5E)-2-butan-2-ylidene-5-(1,1-difluoroethyl)hepta-3,5-dienyl]formamide |
| SMILES | C/C=C(\C=C/C(CNC=O)=C(\C)CC)C(C)(F)F |
| InChI | InChI=1S/C14H21F2NO/c1-5-11(3)12(9-17-10-18)7-8-13(6-2)14(4,15)16/h6-8,10H,5,9H2,1-4H3,(H,17,18)/b8-7-,12-11-,13-6+ |
| InChIKey | IYZAAICRMGYPSE-PKHHVHHSSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|