C13H18F3NO — CID 163661947
N-[(3E,5E)-4-(1,1-difluoroethyl)-7-fluoro-6-methyl-2-methylidenehepta-3,5-dienyl]acetamide (PubChem CID 163661947) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is N-[(3E,5E)-4-(1,1-difluoroethyl)-7-fluoro-6-methyl-2-methylidenehepta-3,5-dienyl]acetamide.
| Compound Name | N-[(3E,5E)-4-(1,1-difluoroethyl)-7-fluoro-6-methyl-2-methylidenehepta-3,5-dienyl]acetamide |
|---|---|
| PubChem CID | 163661947 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(3E,5E)-4-(1,1-difluoroethyl)-7-fluoro-6-methyl-2-methylidenehepta-3,5-dienyl]acetamide |
| SMILES | C=C(/C=C(\C=C(/C)CF)C(C)(F)F)CNC(C)=O |
| InChI | InChI=1S/C13H18F3NO/c1-9(7-14)5-12(13(4,15)16)6-10(2)8-17-11(3)18/h5-6H,2,7-8H2,1,3-4H3,(H,17,18)/b9-5+,12-6+ |
| InChIKey | IVEICXQXDZSNTN-BGNLXQKFSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|