C16H25F2NO — CID 53959963
11,11-difluoro-3-methyl-N-(2-methylpropyl)undeca-2,4,10-trienamide (PubChem CID 53959963) has the molecular formula C16H25F2NO and a molecular weight of 285.37 g/mol. Its IUPAC name is 11,11-difluoro-3-methyl-N-(2-methylpropyl)undeca-2,4,10-trienamide.
| Compound Name | 11,11-difluoro-3-methyl-N-(2-methylpropyl)undeca-2,4,10-trienamide |
|---|---|
| PubChem CID | 53959963 |
| Molecular Formula | C16H25F2NO |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 11,11-difluoro-3-methyl-N-(2-methylpropyl)undeca-2,4,10-trienamide |
| SMILES | CC(C)CNC(=O)C=C(C)C=CCCCCC=C(F)F |
| InChI | InChI=1S/C16H25F2NO/c1-13(2)12-19-16(20)11-14(3)9-7-5-4-6-8-10-15(17)18/h7,9-11,13H,4-6,8,12H2,1-3H3,(H,19,20) |
| InChIKey | JKGIDQWVMVUYFQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | 367 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|