C15H23F2NO — CID 57078252
11,11-difluoro-N-(2-methylpropyl)undeca-2,4,10-trienamide (PubChem CID 57078252) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is 11,11-difluoro-N-(2-methylpropyl)undeca-2,4,10-trienamide.
| Compound Name | 11,11-difluoro-N-(2-methylpropyl)undeca-2,4,10-trienamide |
|---|---|
| PubChem CID | 57078252 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 11,11-difluoro-N-(2-methylpropyl)undeca-2,4,10-trienamide |
| SMILES | CC(C)CNC(=O)C=CC=CCCCCC=C(F)F |
| InChI | InChI=1S/C15H23F2NO/c1-13(2)12-18-15(19)11-9-7-5-3-4-6-8-10-14(16)17/h5,7,9-11,13H,3-4,6,8,12H2,1-2H3,(H,18,19) |
| InChIKey | IQKHYDHPCMYDLK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|