C11H13F6NO — CID 143094181
N-[(E)-5,5,5-trifluoro-4-methyl-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enyl]formamide (PubChem CID 143094181) has the molecular formula C11H13F6NO and a molecular weight of 289.22 g/mol. Its IUPAC name is N-[(E)-5,5,5-trifluoro-4-methyl-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enyl]formamide.
| Compound Name | N-[(E)-5,5,5-trifluoro-4-methyl-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enyl]formamide |
|---|---|
| PubChem CID | 143094181 |
| Molecular Formula | C11H13F6NO |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[(E)-5,5,5-trifluoro-4-methyl-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]pent-2-enyl]formamide |
| SMILES | C/C(=C\C(=C/C(C)C(F)(F)F)CNC=O)C(F)(F)F |
| InChI | InChI=1S/C11H13F6NO/c1-7(10(12,13)14)3-9(5-18-6-19)4-8(2)11(15,16)17/h3-4,6-7H,5H2,1-2H3,(H,18,19)/b8-4+,9-3+ |
| InChIKey | UTAIUOOLYDLFER-VBAIDPPHSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|