C10H11F2NO — CID 142297290
N-[[(2E,4E)-2,4-difluorocycloocta-2,4,7-trien-1-yl]methyl]formamide (PubChem CID 142297290) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is N-[[(2E,4E)-2,4-difluorocycloocta-2,4,7-trien-1-yl]methyl]formamide.
| Compound Name | N-[[(2E,4E)-2,4-difluorocycloocta-2,4,7-trien-1-yl]methyl]formamide |
|---|---|
| PubChem CID | 142297290 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-[[(2E,4E)-2,4-difluorocycloocta-2,4,7-trien-1-yl]methyl]formamide |
| SMILES | O=CNCC1C=CC/C=C(F)\C=C/1F |
| InChI | InChI=1S/C10H11F2NO/c11-9-4-2-1-3-8(6-13-7-14)10(12)5-9/h1,3-5,7-8H,2,6H2,(H,13,14)/b3-1?,9-4+,10-5+ |
| InChIKey | IXBRGSLPMRCXPJ-GPOSXRTMSA-N |
| XLogP | 2.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|