C10H12FNO — CID 143501668
N-[2-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethyl]formamide (PubChem CID 143501668) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is N-[2-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethyl]formamide.
| Compound Name | N-[2-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethyl]formamide |
|---|---|
| PubChem CID | 143501668 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-[2-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethyl]formamide |
| SMILES | O=CNCCC1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C10H12FNO/c11-10-3-1-2-9(4-5-10)6-7-12-8-13/h2-5,8H,1,6-7H2,(H,12,13) |
| InChIKey | ZOKJQAUOKCJBTP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|