C10H18N2O — CID 89030350
2-ethylhepta-2,4-dienylurea (PubChem CID 89030350) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-ethylhepta-2,4-dienylurea.
| Compound Name | 2-ethylhepta-2,4-dienylurea |
|---|---|
| PubChem CID | 89030350 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-ethylhepta-2,4-dienylurea |
| SMILES | CCC=CC=C(CC)CNC(N)=O |
| InChI | InChI=1S/C10H18N2O/c1-3-5-6-7-9(4-2)8-12-10(11)13/h5-7H,3-4,8H2,1-2H3,(H3,11,12,13) |
| InChIKey | UQNDBNLIDIAREC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|