C8H9FN2O — CID 123540131
(3-fluoro-6-methylidenecyclohexa-2,4-dien-1-yl)urea (PubChem CID 123540131) has the molecular formula C8H9FN2O and a molecular weight of 168.17 g/mol. Its IUPAC name is (3-fluoro-6-methylidenecyclohexa-2,4-dien-1-yl)urea.
| Compound Name | (3-fluoro-6-methylidenecyclohexa-2,4-dien-1-yl)urea |
|---|---|
| PubChem CID | 123540131 |
| Molecular Formula | C8H9FN2O |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | (3-fluoro-6-methylidenecyclohexa-2,4-dien-1-yl)urea |
| SMILES | C=C1C=CC(F)=CC1NC(N)=O |
| InChI | InChI=1S/C8H9FN2O/c1-5-2-3-6(9)4-7(5)11-8(10)12/h2-4,7H,1H2,(H3,10,11,12) |
| InChIKey | XIZBTILGEUNMJM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |