C8H11FN2O — CID 164902264
[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]urea (PubChem CID 164902264) has the molecular formula C8H11FN2O and a molecular weight of 170.19 g/mol. Its IUPAC name is [(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]urea.
| Compound Name | [(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]urea |
|---|---|
| PubChem CID | 164902264 |
| Molecular Formula | C8H11FN2O |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | [(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]urea |
| SMILES | C=C/C(F)=C(\C=C)CNC(N)=O |
| InChI | InChI=1S/C8H11FN2O/c1-3-6(7(9)4-2)5-11-8(10)12/h3-4H,1-2,5H2,(H3,10,11,12)/b7-6- |
| InChIKey | MUUVZMSRMSOZBJ-SREVYHEPSA-N |
| XLogP | 1.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|