C8H12N2O — CID 143467054
[(2E)-2-ethenylpenta-2,4-dienyl]urea (PubChem CID 143467054) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl]urea.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl]urea |
|---|---|
| PubChem CID | 143467054 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl]urea |
| SMILES | C=C/C=C(\C=C)CNC(N)=O |
| InChI | InChI=1S/C8H12N2O/c1-3-5-7(4-2)6-10-8(9)11/h3-5H,1-2,6H2,(H3,9,10,11)/b7-5+ |
| InChIKey | BSGSIJXZDVWOCV-FNORWQNLSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|