C9H16N2O — CID 123136968
3-methylhepta-3,5-dien-2-ylurea (PubChem CID 123136968) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-methylhepta-3,5-dien-2-ylurea.
| Compound Name | 3-methylhepta-3,5-dien-2-ylurea |
|---|---|
| PubChem CID | 123136968 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-methylhepta-3,5-dien-2-ylurea |
| SMILES | CC=CC=C(C)C(C)NC(N)=O |
| InChI | InChI=1S/C9H16N2O/c1-4-5-6-7(2)8(3)11-9(10)12/h4-6,8H,1-3H3,(H3,10,11,12) |
| InChIKey | LOHFJYFNJDHESF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|