C13H17FN2O — CID 143509226
1-buta-1,3-dien-2-yl-3-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethyl]urea (PubChem CID 143509226) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-3-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethyl]urea.
| Compound Name | 1-buta-1,3-dien-2-yl-3-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 143509226 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-3-[1-(4-fluorocyclohexa-1,5-dien-1-yl)ethyl]urea |
| SMILES | C=CC(=C)NC(=O)NC(C)C1=CCC(F)C=C1 |
| InChI | InChI=1S/C13H17FN2O/c1-4-9(2)15-13(17)16-10(3)11-5-7-12(14)8-6-11/h4-7,10,12H,1-2,8H2,3H3,(H2,15,16,17) |
| InChIKey | ZHJJHVZGAJKPDW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|