C11H18FNS — CID 163458330
(1S)-1-ethylsulfanyl-N-[[(4R)-4-fluorocyclohexa-1,5-dien-1-yl]methyl]ethanamine (PubChem CID 163458330) has the molecular formula C11H18FNS and a molecular weight of 215.34 g/mol. Its IUPAC name is (1S)-1-ethylsulfanyl-N-[[(4R)-4-fluorocyclohexa-1,5-dien-1-yl]methyl]ethanamine.
| Compound Name | (1S)-1-ethylsulfanyl-N-[[(4R)-4-fluorocyclohexa-1,5-dien-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 163458330 |
| Molecular Formula | C11H18FNS |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (1S)-1-ethylsulfanyl-N-[[(4R)-4-fluorocyclohexa-1,5-dien-1-yl]methyl]ethanamine |
| SMILES | CCS[C@@H](C)NCC1=CC[C@@H](F)C=C1 |
| InChI | InChI=1S/C11H18FNS/c1-3-14-9(2)13-8-10-4-6-11(12)7-5-10/h4-6,9,11,13H,3,7-8H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | BMKLWZSKLGKSQN-ONGXEEELSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|