C17H20F6N2O — CID 167645088
1-[(2E,4E)-2-ethenylhexa-2,4-dienyl]-3-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea;fluoroform (PubChem CID 167645088) has the molecular formula C17H20F6N2O and a molecular weight of 382.35 g/mol. Its IUPAC name is 1-[(2E,4E)-2-ethenylhexa-2,4-dienyl]-3-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea;fluoroform.
| Compound Name | 1-[(2E,4E)-2-ethenylhexa-2,4-dienyl]-3-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea;fluoroform |
|---|---|
| PubChem CID | 167645088 |
| Molecular Formula | C17H20F6N2O |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[(2E,4E)-2-ethenylhexa-2,4-dienyl]-3-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea;fluoroform |
| SMILES | C=C/C(=C\C=C\C)CNC(=O)NC1C=C(C(F)(F)F)C=CC1.FC(F)F |
| InChI | InChI=1S/C16H19F3N2O.CHF3/c1-3-5-7-12(4-2)11-20-15(22)21-14-9-6-8-13(10-14)16(17,18)19;2-1(3)4/h3-8,10,14H,2,9,11H2,1H3,(H2,20,21,22);1H/b5-3+,12-7+; |
| InChIKey | PTCMRWIEOWZAHB-KFECVFGFSA-N |
| XLogP | 4.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|