C15H16N2O — CID 134104947
1,3-di(cyclohepta-2,4,6-trien-1-yl)urea (PubChem CID 134104947) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1,3-di(cyclohepta-2,4,6-trien-1-yl)urea.
| Compound Name | 1,3-di(cyclohepta-2,4,6-trien-1-yl)urea |
|---|---|
| PubChem CID | 134104947 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1,3-di(cyclohepta-2,4,6-trien-1-yl)urea |
| SMILES | O=C(NC1C=CC=CC=C1)NC1C=CC=CC=C1 |
| InChI | InChI=1S/C15H16N2O/c18-15(16-13-9-5-1-2-6-10-13)17-14-11-7-3-4-8-12-14/h1-14H,(H2,16,17,18) |
| InChIKey | IOJKXNMQTVPBLX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |