C9H12N2O — CID 142207381
1-cyclohepta-1,4,6-trien-1-yl-3-methylurea (PubChem CID 142207381) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-cyclohepta-1,4,6-trien-1-yl-3-methylurea.
| Compound Name | 1-cyclohepta-1,4,6-trien-1-yl-3-methylurea |
|---|---|
| PubChem CID | 142207381 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-cyclohepta-1,4,6-trien-1-yl-3-methylurea |
| SMILES | CNC(=O)NC1=CCC=CC=C1 |
| InChI | InChI=1S/C9H12N2O/c1-10-9(12)11-8-6-4-2-3-5-7-8/h2-4,6-7H,5H2,1H3,(H2,10,11,12) |
| InChIKey | XCXQHTDFSVNINH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |