C11H16N2O — CID 88606753
1,3-bis(penta-1,4-dien-3-yl)urea (PubChem CID 88606753) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1,3-bis(penta-1,4-dien-3-yl)urea.
| Compound Name | 1,3-bis(penta-1,4-dien-3-yl)urea |
|---|---|
| PubChem CID | 88606753 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1,3-bis(penta-1,4-dien-3-yl)urea |
| SMILES | C=CC(C=C)NC(=O)NC(C=C)C=C |
| InChI | InChI=1S/C11H16N2O/c1-5-9(6-2)12-11(14)13-10(7-3)8-4/h5-10H,1-4H2,(H2,12,13,14) |
| InChIKey | SEIZCPLJRUGWHV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|