C10H16N2O — CID 91248256
1-methyl-3-(3-methylidenehepta-4,6-dien-2-yl)urea (PubChem CID 91248256) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-methyl-3-(3-methylidenehepta-4,6-dien-2-yl)urea.
| Compound Name | 1-methyl-3-(3-methylidenehepta-4,6-dien-2-yl)urea |
|---|---|
| PubChem CID | 91248256 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-methyl-3-(3-methylidenehepta-4,6-dien-2-yl)urea |
| SMILES | C=CC=CC(=C)C(C)NC(=O)NC |
| InChI | InChI=1S/C10H16N2O/c1-5-6-7-8(2)9(3)12-10(13)11-4/h5-7,9H,1-2H2,3-4H3,(H2,11,12,13) |
| InChIKey | KFCRWLDNGGFSHK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|