C10H13NO — CID 126633431
N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]formamide (PubChem CID 126633431) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]formamide.
| Compound Name | N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]formamide |
|---|---|
| PubChem CID | 126633431 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]formamide |
| SMILES | C=C/C=C\C=C(/C=C)CNC=O |
| InChI | InChI=1S/C10H13NO/c1-3-5-6-7-10(4-2)8-11-9-12/h3-7,9H,1-2,8H2,(H,11,12)/b6-5-,10-7+ |
| InChIKey | GHPZBJDPNGIBSK-ZZWPSLBBSA-N |
| XLogP | 1.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|