C8H10FNO — CID 164902160
N-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]formamide (PubChem CID 164902160) has the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. Its IUPAC name is N-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]formamide.
| Compound Name | N-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 164902160 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]formamide |
| SMILES | C=C/C(F)=C(\C=C)CNC=O |
| InChI | InChI=1S/C8H10FNO/c1-3-7(5-10-6-11)8(9)4-2/h3-4,6H,1-2,5H2,(H,10,11)/b8-7- |
| InChIKey | WSEXFMOAODHWOC-FPLPWBNLSA-N |
| XLogP | 1.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|