C8H13N3O — CID 138478266
[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]urea (PubChem CID 138478266) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is [(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]urea.
| Compound Name | [(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]urea |
|---|---|
| PubChem CID | 138478266 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | [(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]urea |
| SMILES | C=C/C=C(\C=C/N)CNC(N)=O |
| InChI | InChI=1S/C8H13N3O/c1-2-3-7(4-5-9)6-11-8(10)12/h2-5H,1,6,9H2,(H3,10,11,12)/b5-4-,7-3+ |
| InChIKey | SLMOJOKBEWLOTM-SBYNAHCQSA-N |
| XLogP | 0.24 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|