C10H16N2O — CID 145287162
1-[(2E)-2-ethenylpenta-2,4-dienyl]-1,3-dimethylurea (PubChem CID 145287162) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-1,3-dimethylurea.
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 145287162 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-1,3-dimethylurea |
| SMILES | C=C/C=C(\C=C)CN(C)C(=O)NC |
| InChI | InChI=1S/C10H16N2O/c1-5-7-9(6-2)8-12(4)10(13)11-3/h5-7H,1-2,8H2,3-4H3,(H,11,13)/b9-7+ |
| InChIKey | BEBYSVTWVWSOCN-VQHVLOKHSA-N |
| XLogP | 1.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|