About [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea
[(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea (PubChem CID 89058335) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea.
Molecular Properties
| Compound Name | [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea |
| PubChem CID | 89058335 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea |
| SMILES | C=C(/C=C\C=C/C)CCNC(N)=O |
| InChI | InChI=1S/C10H16N2O/c1-3-4-5-6-9(2)7-8-12-10(11)13/h3-6H,2,7-8H2,1H3,(H3,11,12,13)/b4-3-,6-5- |
| InChIKey | POKQAXIZYZIDMB-OUPQRBNQSA-N |
| XLogP | 1.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea?
The IUPAC name of [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea (CID 89058335) is [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea.
What is the SMILES notation for [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea?
The canonical SMILES for [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea is C=C(/C=C\C=C/C)CCNC(N)=O.
What is the InChIKey of [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea?
The InChIKey is POKQAXIZYZIDMB-OUPQRBNQSA-N. The full InChI is InChI=1S/C10H16N2O/c1-3-4-5-6-9(2)7-8-12-10(11)13/h3-6H,2,7-8H2,1H3,(H3,11,12,13)/b4-3-,6-5-.
What are the key properties of [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea?
[(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea has a molecular weight of 180.25 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,6Z)-3-methylideneocta-4,6-dienyl]urea is sourced from PubChem (CID 89058335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).