C20H18O2 — CID 175775903
1-benzhydrylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 175775903) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-benzhydrylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 1-benzhydrylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 175775903 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-benzhydrylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1(C(c2ccccc2)c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C20H18O2/c21-19(22)20(14-8-3-9-15-20)18(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-14,18H,15H2,(H,21,22) |
| InChIKey | BTYRKLLQCXJCHO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |