C16H19N — CID 67642916
1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine (PubChem CID 67642916) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine.
| Compound Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine |
|---|---|
| PubChem CID | 67642916 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine |
| SMILES | CC(/N=C/C1(C)C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C16H19N/c1-14(15-9-5-3-6-10-15)17-13-16(2)11-7-4-8-12-16/h3-11,13-14H,12H2,1-2H3/b17-13+ |
| InChIKey | IBNDLNVGUDFNIS-GHRIWEEISA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|