About 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine
1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine (PubChem CID 67642916) has the molecular formula C16H19N
and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine.
Molecular Properties
| Compound Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine |
| PubChem CID | 67642916 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine |
| SMILES | CC(/N=C/C1(C)C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C16H19N/c1-14(15-9-5-3-6-10-15)17-13-16(2)11-7-4-8-12-16/h3-11,13-14H,12H2,1-2H3/b17-13+ |
| InChIKey | IBNDLNVGUDFNIS-GHRIWEEISA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine?
The IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine (CID 67642916) is 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine.
What is the SMILES notation for 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine?
The canonical SMILES for 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine is CC(/N=C/C1(C)C=CC=CC1)c1ccccc1.
What is the InChIKey of 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine?
The InChIKey is IBNDLNVGUDFNIS-GHRIWEEISA-N. The full InChI is InChI=1S/C16H19N/c1-14(15-9-5-3-6-10-15)17-13-16(2)11-7-4-8-12-16/h3-11,13-14H,12H2,1-2H3/b17-13+.
What are the key properties of 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine?
1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine has a molecular weight of 225.33 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylcyclohexa-2,4-dien-1-yl)-N-(1-phenylethyl)methanimine is sourced from PubChem (CID 67642916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).