C12H17NO2 — CID 11651382
2,2-dimethoxy-N-(1-phenylethyl)ethanimine (PubChem CID 11651382) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2,2-dimethoxy-N-(1-phenylethyl)ethanimine.
| Compound Name | 2,2-dimethoxy-N-(1-phenylethyl)ethanimine |
|---|---|
| PubChem CID | 11651382 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2,2-dimethoxy-N-(1-phenylethyl)ethanimine |
| SMILES | COC(/C=N/C(C)c1ccccc1)OC |
| InChI | InChI=1S/C12H17NO2/c1-10(11-7-5-4-6-8-11)13-9-12(14-2)15-3/h4-10,12H,1-3H3/b13-9+ |
| InChIKey | BBXIWRCTYUYRFH-UKTHLTGXSA-N |
| XLogP | 2.44 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|