C45H42N3OP — CID 101273212
1-[2-bis[2-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phosphorylphenyl]-N-[(1S)-1-phenylethyl]methanimine (PubChem CID 101273212) has the molecular formula C45H42N3OP and a molecular weight of 671.83 g/mol. Its IUPAC name is 1-[2-bis[2-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phosphorylphenyl]-N-[(1S)-1-phenylethyl]methanimine.
| Compound Name | 1-[2-bis[2-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phosphorylphenyl]-N-[(1S)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 101273212 |
| Molecular Formula | C45H42N3OP |
| Molecular Weight | 671.83 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | 1-[2-bis[2-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phosphorylphenyl]-N-[(1S)-1-phenylethyl]methanimine |
| SMILES | C[C@H](/N=C\c1ccccc1P(=O)(c1ccccc1/C=N\[C@@H](C)c1ccccc1)c1ccccc1/C=N/[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H42N3OP/c1-34(37-19-7-4-8-20-37)46-31-40-25-13-16-28-43(40)50(49,44-29-17-14-26-41(44)32-47-35(2)38-21-9-5-10-22-38)45-30-18-15-27-42(45)33-48-36(3)39-23-11-6-12-24-39/h4-36H,1-3H3/b46-31-,47-32-,48-33+/t34-,35-,36-/m0/s1 |
| InChIKey | MQJLCFAVGRECHG-AAZSSGCWSA-N |
| XLogP | 9.87 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.83 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|