C20H24N2 — CID 10493884
N-[(1R)-1-phenylethyl]-1-(2-piperidin-1-ylphenyl)methanimine (PubChem CID 10493884) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-1-(2-piperidin-1-ylphenyl)methanimine.
| Compound Name | N-[(1R)-1-phenylethyl]-1-(2-piperidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 10493884 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-1-(2-piperidin-1-ylphenyl)methanimine |
| SMILES | C[C@@H](/N=C/c1ccccc1N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2/c1-17(18-10-4-2-5-11-18)21-16-19-12-6-7-13-20(19)22-14-8-3-9-15-22/h2,4-7,10-13,16-17H,3,8-9,14-15H2,1H3/b21-16+/t17-/m1/s1 |
| InChIKey | SEXBYPINRLSVGP-GFXBCDTMSA-N |
| XLogP | 4.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|