C25H33N3O3 — CID 3716632
1,3-dicyclohexyl-6-hydroxy-5-(1-phenylethyliminomethyl)pyrimidine-2,4-dione (PubChem CID 3716632) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1,3-dicyclohexyl-6-hydroxy-5-(1-phenylethyliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 1,3-dicyclohexyl-6-hydroxy-5-(1-phenylethyliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3716632 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1,3-dicyclohexyl-6-hydroxy-5-(1-phenylethyliminomethyl)pyrimidine-2,4-dione |
| SMILES | CC(/N=C/c1c(O)n(C2CCCCC2)c(=O)n(C2CCCCC2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O3/c1-18(19-11-5-2-6-12-19)26-17-22-23(29)27(20-13-7-3-8-14-20)25(31)28(24(22)30)21-15-9-4-10-16-21/h2,5-6,11-12,17-18,20-21,29H,3-4,7-10,13-16H2,1H3/b26-17+ |
| InChIKey | FBBQGJSOMBEROV-YZSQISJMSA-N |
| XLogP | 4.91 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|