C26H35N3O5 — CID 3812735
1,3-dicyclohexyl-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3812735) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1,3-dicyclohexyl-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3812735 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 1,3-dicyclohexyl-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1cc(C/N=C/c2c(O)n(C3CCCCC3)c(=O)n(C3CCCCC3)c2=O)cc(OC)c1 |
| InChI | InChI=1S/C26H35N3O5/c1-33-21-13-18(14-22(15-21)34-2)16-27-17-23-24(30)28(19-9-5-3-6-10-19)26(32)29(25(23)31)20-11-7-4-8-12-20/h13-15,17,19-20,30H,3-12,16H2,1-2H3/b27-17+ |
| InChIKey | OKFDADJIRXCJRN-WPWMEQJKSA-N |
| XLogP | 4.36 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|