C22H27N3O7 — CID 130357111
1-cyclohexyl-3-[(3,5-dimethoxyphenyl)methyl]-4-hydroxy-2,6-dioxo-N-(2-oxoethyl)pyrimidine-5-carboxamide (PubChem CID 130357111) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3,5-dimethoxyphenyl)methyl]-4-hydroxy-2,6-dioxo-N-(2-oxoethyl)pyrimidine-5-carboxamide.
| Compound Name | 1-cyclohexyl-3-[(3,5-dimethoxyphenyl)methyl]-4-hydroxy-2,6-dioxo-N-(2-oxoethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 130357111 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-cyclohexyl-3-[(3,5-dimethoxyphenyl)methyl]-4-hydroxy-2,6-dioxo-N-(2-oxoethyl)pyrimidine-5-carboxamide |
| SMILES | COc1cc(Cn2c(O)c(C(=O)NCC=O)c(=O)n(C3CCCCC3)c2=O)cc(OC)c1 |
| InChI | InChI=1S/C22H27N3O7/c1-31-16-10-14(11-17(12-16)32-2)13-24-20(28)18(19(27)23-8-9-26)21(29)25(22(24)30)15-6-4-3-5-7-15/h9-12,15,28H,3-8,13H2,1-2H3,(H,23,27) |
| InChIKey | QNHNGMXFQLHSMV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|