C22H29N3O3S — CID 3702444
1,3-dicyclohexyl-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione (PubChem CID 3702444) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 1,3-dicyclohexyl-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 1,3-dicyclohexyl-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3702444 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1,3-dicyclohexyl-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione |
| SMILES | O=c1c(/C=N/Cc2cccs2)c(O)n(C2CCCCC2)c(=O)n1C1CCCCC1 |
| InChI | InChI=1S/C22H29N3O3S/c26-20-19(15-23-14-18-12-7-13-29-18)21(27)25(17-10-5-2-6-11-17)22(28)24(20)16-8-3-1-4-9-16/h7,12-13,15-17,26H,1-6,8-11,14H2/b23-15+ |
| InChIKey | ZMXPQDBBBQOOGF-HZHRSRAPSA-N |
| XLogP | 4.41 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|