C24H28N2O2 — CID 90883448
1-benzyl-3-cyclohexyl-4-hydroxy-5-(2-phenylethyl)imidazol-2-one (PubChem CID 90883448) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-benzyl-3-cyclohexyl-4-hydroxy-5-(2-phenylethyl)imidazol-2-one.
| Compound Name | 1-benzyl-3-cyclohexyl-4-hydroxy-5-(2-phenylethyl)imidazol-2-one |
|---|---|
| PubChem CID | 90883448 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-benzyl-3-cyclohexyl-4-hydroxy-5-(2-phenylethyl)imidazol-2-one |
| SMILES | O=c1n(Cc2ccccc2)c(CCc2ccccc2)c(O)n1C1CCCCC1 |
| InChI | InChI=1S/C24H28N2O2/c27-23-22(17-16-19-10-4-1-5-11-19)25(18-20-12-6-2-7-13-20)24(28)26(23)21-14-8-3-9-15-21/h1-2,4-7,10-13,21,27H,3,8-9,14-18H2 |
| InChIKey | JAPISNPJWWHNDV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |