C23H22N4O2 — CID 73293163
7-benzyl-9-cyclopentyl-6-phenoxypurin-8-one (PubChem CID 73293163) has the molecular formula C23H22N4O2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 7-benzyl-9-cyclopentyl-6-phenoxypurin-8-one.
| Compound Name | 7-benzyl-9-cyclopentyl-6-phenoxypurin-8-one |
|---|---|
| PubChem CID | 73293163 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 7-benzyl-9-cyclopentyl-6-phenoxypurin-8-one |
| SMILES | O=c1n(Cc2ccccc2)c2c(Oc3ccccc3)ncnc2n1C1CCCC1 |
| InChI | InChI=1S/C23H22N4O2/c28-23-26(15-17-9-3-1-4-10-17)20-21(27(23)18-11-7-8-12-18)24-16-25-22(20)29-19-13-5-2-6-14-19/h1-6,9-10,13-14,16,18H,7-8,11-12,15H2 |
| InChIKey | IWEHZMOLKVQODL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |