C20H26N2O4S — CID 54437381
3-[3-cyclopentyl-5-hydroxy-2-oxo-1-(1-phenyl-3-sulfanylpropan-2-yl)imidazol-4-yl]propanoic acid (PubChem CID 54437381) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-[3-cyclopentyl-5-hydroxy-2-oxo-1-(1-phenyl-3-sulfanylpropan-2-yl)imidazol-4-yl]propanoic acid.
| Compound Name | 3-[3-cyclopentyl-5-hydroxy-2-oxo-1-(1-phenyl-3-sulfanylpropan-2-yl)imidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 54437381 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3-[3-cyclopentyl-5-hydroxy-2-oxo-1-(1-phenyl-3-sulfanylpropan-2-yl)imidazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1c(O)n(C(CS)Cc2ccccc2)c(=O)n1C1CCCC1 |
| InChI | InChI=1S/C20H26N2O4S/c23-18(24)11-10-17-19(25)22(20(26)21(17)15-8-4-5-9-15)16(13-27)12-14-6-2-1-3-7-14/h1-3,6-7,15-16,25,27H,4-5,8-13H2,(H,23,24) |
| InChIKey | WLRJXLWSCDZWOJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|