C23H27ClFN3O3 — CID 2232438
5-[(4-chloro-3-fluorophenyl)iminomethyl]-1,3-dicyclohexyl-6-hydroxypyrimidine-2,4-dione (PubChem CID 2232438) has the molecular formula C23H27ClFN3O3 and a molecular weight of 447.94 g/mol. Its IUPAC name is 5-[(4-chloro-3-fluorophenyl)iminomethyl]-1,3-dicyclohexyl-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[(4-chloro-3-fluorophenyl)iminomethyl]-1,3-dicyclohexyl-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2232438 |
| Molecular Formula | C23H27ClFN3O3 |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 5-[(4-chloro-3-fluorophenyl)iminomethyl]-1,3-dicyclohexyl-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1c(/C=N/c2ccc(Cl)c(F)c2)c(O)n(C2CCCCC2)c(=O)n1C1CCCCC1 |
| InChI | InChI=1S/C23H27ClFN3O3/c24-19-12-11-15(13-20(19)25)26-14-18-21(29)27(16-7-3-1-4-8-16)23(31)28(22(18)30)17-9-5-2-6-10-17/h11-14,16-17,29H,1-10H2/b26-14+ |
| InChIKey | CYYWNGQGKVZULZ-VULFUBBASA-N |
| XLogP | 5.27 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|