C25H27NO2 — CID 174371604
1-(1-benzhydrylcyclohexa-2,4-dien-1-yl)piperidine-3-carboxylic acid (PubChem CID 174371604) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(1-benzhydrylcyclohexa-2,4-dien-1-yl)piperidine-3-carboxylic acid.
| Compound Name | 1-(1-benzhydrylcyclohexa-2,4-dien-1-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 174371604 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-(1-benzhydrylcyclohexa-2,4-dien-1-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C2(C(c3ccccc3)c3ccccc3)C=CC=CC2)C1 |
| InChI | InChI=1S/C25H27NO2/c27-24(28)22-15-10-18-26(19-22)25(16-8-3-9-17-25)23(20-11-4-1-5-12-20)21-13-6-2-7-14-21/h1-9,11-14,16,22-23H,10,15,17-19H2,(H,27,28) |
| InChIKey | BNPJGBZKKNYOEA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |