C13H20N2O5 — CID 160723314
1-aminocyclohexa-2,4-diene-1-carboxylic acid;1-(oxiran-2-yl)-N-(oxiran-2-ylmethoxy)methanamine (PubChem CID 160723314) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-aminocyclohexa-2,4-diene-1-carboxylic acid;1-(oxiran-2-yl)-N-(oxiran-2-ylmethoxy)methanamine.
| Compound Name | 1-aminocyclohexa-2,4-diene-1-carboxylic acid;1-(oxiran-2-yl)-N-(oxiran-2-ylmethoxy)methanamine |
|---|---|
| PubChem CID | 160723314 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-aminocyclohexa-2,4-diene-1-carboxylic acid;1-(oxiran-2-yl)-N-(oxiran-2-ylmethoxy)methanamine |
| SMILES | C(NOCC1CO1)C1CO1.NC1(C(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C7H9NO2.C6H11NO3/c8-7(6(9)10)4-2-1-3-5-7;1(5-2-8-5)7-10-4-6-3-9-6/h1-4H,5,8H2,(H,9,10);5-7H,1-4H2 |
| InChIKey | RTJOBCMLYOHODS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|