C6H10N2O4S — CID 97049650
[[(1R)-1-aminocyclohexa-2,4-dien-1-yl]amino] hydrogen sulfate (PubChem CID 97049650) has the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. Its IUPAC name is [[(1R)-1-aminocyclohexa-2,4-dien-1-yl]amino] hydrogen sulfate.
| Compound Name | [[(1R)-1-aminocyclohexa-2,4-dien-1-yl]amino] hydrogen sulfate |
|---|---|
| PubChem CID | 97049650 |
| Molecular Formula | C6H10N2O4S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | [[(1R)-1-aminocyclohexa-2,4-dien-1-yl]amino] hydrogen sulfate |
| SMILES | N[C@]1(NOS(=O)(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C6H10N2O4S/c7-6(4-2-1-3-5-6)8-12-13(9,10)11/h1-4,8H,5,7H2,(H,9,10,11)/t6-/m0/s1 |
| InChIKey | ZEDWFNGYLXOVTF-LURJTMIESA-N |
| XLogP | -0.52 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|