C7H11ClSSi — CID 174990856
chloro-(1-methylcyclohexa-2,4-dien-1-yl)sulfanylsilane (PubChem CID 174990856) has the molecular formula C7H11ClSSi and a molecular weight of 190.77 g/mol. Its IUPAC name is chloro-(1-methylcyclohexa-2,4-dien-1-yl)sulfanylsilane.
| Compound Name | chloro-(1-methylcyclohexa-2,4-dien-1-yl)sulfanylsilane |
|---|---|
| PubChem CID | 174990856 |
| Molecular Formula | C7H11ClSSi |
| Molecular Weight | 190.77 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | chloro-(1-methylcyclohexa-2,4-dien-1-yl)sulfanylsilane |
| SMILES | CC1(S[SiH2]Cl)C=CC=CC1 |
| InChI | InChI=1S/C7H11ClSSi/c1-7(9-10-8)5-3-2-4-6-7/h2-5H,6,10H2,1H3 |
| InChIKey | WNTCBBBTLMBPHT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.77 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|