C18H24N2 — CID 152745729
1-(2-tert-butylphenyl)-4-methylcyclohexa-2,4-diene-1-carboximidamide (PubChem CID 152745729) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-4-methylcyclohexa-2,4-diene-1-carboximidamide.
| Compound Name | 1-(2-tert-butylphenyl)-4-methylcyclohexa-2,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 152745729 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-(2-tert-butylphenyl)-4-methylcyclohexa-2,4-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(c2ccccc2C(C)(C)C)C=CC(C)=CC1 |
| InChI | InChI=1S/C18H24N2/c1-13-9-11-18(12-10-13,16(19)20)15-8-6-5-7-14(15)17(2,3)4/h5-11H,12H2,1-4H3,(H3,19,20) |
| InChIKey | JJFYKBKQFBIBTE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|