C25H20N2 — CID 121420799
(4'bS)-4'b,7'-dimethylspiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-8aH-fluorene] (PubChem CID 121420799) has the molecular formula C25H20N2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (4'bS)-4'b,7'-dimethylspiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-8aH-fluorene].
| Compound Name | (4'bS)-4'b,7'-dimethylspiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-8aH-fluorene] |
|---|---|
| PubChem CID | 121420799 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (4'bS)-4'b,7'-dimethylspiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-8aH-fluorene] |
| SMILES | CC1=CC2C3(c4ccccc4[C@@]2(C)C=C1)c1cccnc1-c1ncccc13 |
| InChI | InChI=1S/C25H20N2/c1-16-11-12-24(2)17-7-3-4-8-18(17)25(21(24)15-16)19-9-5-13-26-22(19)23-20(25)10-6-14-27-23/h3-15,21H,1-2H3/t21?,24-/m1/s1 |
| InChIKey | IOYZDKQTELXYNX-MQNHUJCZSA-N |
| XLogP | 5.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |