C36H26N2O2 — CID 102167961
(5S,6S)-5,6-bis(4-phenylphenyl)-1,10-phenanthroline-5,6-diol (PubChem CID 102167961) has the molecular formula C36H26N2O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is (5S,6S)-5,6-bis(4-phenylphenyl)-1,10-phenanthroline-5,6-diol.
| Compound Name | (5S,6S)-5,6-bis(4-phenylphenyl)-1,10-phenanthroline-5,6-diol |
|---|---|
| PubChem CID | 102167961 |
| Molecular Formula | C36H26N2O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (5S,6S)-5,6-bis(4-phenylphenyl)-1,10-phenanthroline-5,6-diol |
| SMILES | O[C@@]1(c2ccc(-c3ccccc3)cc2)c2cccnc2-c2ncccc2[C@@]1(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H26N2O2/c39-35(29-19-15-27(16-20-29)25-9-3-1-4-10-25)31-13-7-23-37-33(31)34-32(14-8-24-38-34)36(35,40)30-21-17-28(18-22-30)26-11-5-2-6-12-26/h1-24,39-40H/t35-,36-/m0/s1 |
| InChIKey | UJAFCCJDWRFCNQ-ZPGRZCPFSA-N |
| XLogP | 6.96 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |