C18H15N3 — CID 10754733
8-benzyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-amine (PubChem CID 10754733) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 8-benzyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-amine.
| Compound Name | 8-benzyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-amine |
|---|---|
| PubChem CID | 10754733 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 8-benzyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-amine |
| SMILES | NC1(Cc2ccccc2)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C18H15N3/c19-18(12-13-6-2-1-3-7-13)14-8-4-10-20-16(14)17-15(18)9-5-11-21-17/h1-11H,12,19H2 |
| InChIKey | QAZORZQUXVTVKG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |