C16H22O2 — CID 158515643
1,4-dimethylcyclohexa-2,4-dien-1-ol;2,5-dimethylphenol (PubChem CID 158515643) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1,4-dimethylcyclohexa-2,4-dien-1-ol;2,5-dimethylphenol.
| Compound Name | 1,4-dimethylcyclohexa-2,4-dien-1-ol;2,5-dimethylphenol |
|---|---|
| PubChem CID | 158515643 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1,4-dimethylcyclohexa-2,4-dien-1-ol;2,5-dimethylphenol |
| SMILES | CC1=CCC(C)(O)C=C1.Cc1ccc(C)c(O)c1 |
| InChI | InChI=1S/C8H12O.C8H10O/c1-7-3-5-8(2,9)6-4-7;1-6-3-4-7(2)8(9)5-6/h3-5,9H,6H2,1-2H3;3-5,9H,1-2H3 |
| InChIKey | HLPAMLCADQOQFN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |