C14H19NO2 — CID 177469590
(4E,5R)-4-(1-methoxyethylidene)-2,8-dimethyl-2-azaspiro[4.5]deca-6,8-dien-3-one (PubChem CID 177469590) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (4E,5R)-4-(1-methoxyethylidene)-2,8-dimethyl-2-azaspiro[4.5]deca-6,8-dien-3-one.
| Compound Name | (4E,5R)-4-(1-methoxyethylidene)-2,8-dimethyl-2-azaspiro[4.5]deca-6,8-dien-3-one |
|---|---|
| PubChem CID | 177469590 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4E,5R)-4-(1-methoxyethylidene)-2,8-dimethyl-2-azaspiro[4.5]deca-6,8-dien-3-one |
| SMILES | CO/C(C)=C1/C(=O)N(C)C[C@]12C=CC(C)=CC2 |
| InChI | InChI=1S/C14H19NO2/c1-10-5-7-14(8-6-10)9-15(3)13(16)12(14)11(2)17-4/h5-7H,8-9H2,1-4H3/b12-11-/t14-/m1/s1 |
| InChIKey | IRRQFYZTDGGKIK-XMXAVACDSA-N |
| XLogP | 2.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|