C15H21NO4 — CID 101202920
(4Z,5R)-6,8-dimethoxy-4-(1-methoxyethylidene)-2-methyl-2-azaspiro[4.5]deca-6,8-dien-3-one (PubChem CID 101202920) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (4Z,5R)-6,8-dimethoxy-4-(1-methoxyethylidene)-2-methyl-2-azaspiro[4.5]deca-6,8-dien-3-one.
| Compound Name | (4Z,5R)-6,8-dimethoxy-4-(1-methoxyethylidene)-2-methyl-2-azaspiro[4.5]deca-6,8-dien-3-one |
|---|---|
| PubChem CID | 101202920 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (4Z,5R)-6,8-dimethoxy-4-(1-methoxyethylidene)-2-methyl-2-azaspiro[4.5]deca-6,8-dien-3-one |
| SMILES | COC1=CC[C@@]2(CN(C)C(=O)/C2=C(/C)OC)C(OC)=C1 |
| InChI | InChI=1S/C15H21NO4/c1-10(18-3)13-14(17)16(2)9-15(13)7-6-11(19-4)8-12(15)20-5/h6,8H,7,9H2,1-5H3/b13-10+/t15-/m1/s1 |
| InChIKey | MOYPANJZVQIKIF-NRMKIYEFSA-N |
| XLogP | 1.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|