C10H13NO2S — CID 131743944
5-(isocyanomethylsulfonyl)-2,5-dimethylcyclohexa-1,3-diene (PubChem CID 131743944) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-(isocyanomethylsulfonyl)-2,5-dimethylcyclohexa-1,3-diene.
| Compound Name | 5-(isocyanomethylsulfonyl)-2,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 131743944 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 5-(isocyanomethylsulfonyl)-2,5-dimethylcyclohexa-1,3-diene |
| SMILES | [C-]#[N+]CS(=O)(=O)C1(C)C=CC(C)=CC1 |
| InChI | InChI=1S/C10H13NO2S/c1-9-4-6-10(2,7-5-9)14(12,13)8-11-3/h4-6H,7-8H2,1-2H3 |
| InChIKey | LQATYXMYQNMAOB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|